CymitQuimica logo

CAS 1073354-81-0

:

2-(4-fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-(4-Fluorophenyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a 4-fluorophenyl group and a boron-containing dioxaborolane moiety. The presence of the fluorine atom enhances the compound's electronic properties, potentially influencing its reactivity and interactions in various chemical environments. The dioxaborolane group contributes to the compound's stability and solubility, making it suitable for applications in organic synthesis and materials science. This compound may exhibit interesting properties such as fluorescence or catalytic activity, depending on the specific conditions and environments in which it is used. Its molecular structure suggests potential utility in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. As with many boron-containing compounds, it may also play a role in cross-coupling reactions, which are essential in the formation of carbon-carbon bonds in organic synthesis.
Formula:C17H19BFNO2
InChI:InChI=1/C17H19BFNO2/c1-16(2)17(3,4)22-18(21-16)13-7-10-15(20-11-13)12-5-8-14(19)9-6-12/h5-11H,1-4H3
InChI key:CTCLIEHCPOJNSW-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2ccc(c3ccc(cc3)F)nc2)O1
Found 4 products.