CAS 107367-98-6

2-Phenyl-5-methyloxazole-4-acetic acid

Description:

2-Phenyl-5-methyloxazole-4-acetic acid is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a phenyl group and a methyl group attached to the oxazole ring, contributing to its unique properties. The acetic acid functional group indicates that it possesses acidic characteristics, making it potentially useful in various chemical reactions and applications. The presence of the phenyl group can enhance its lipophilicity, influencing its solubility and reactivity in organic solvents. Additionally, the compound may exhibit biological activity, which could be of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further investigation in medicinal chemistry. Overall, 2-Phenyl-5-methyloxazole-4-acetic acid is a compound of interest due to its structural features and potential applications in various fields, including organic synthesis and drug development.

Formula: C₁₂H₁₁NO₃

InChI: InChI=1S/C12H11NO3/c1-8-10(7-11(14)15)13-12(16-8)9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,14,15)

InChI key: InChIKey=XEWJNPORMBGGKZ-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1N=C(OC1C)C2=CC=CC=C2

Synonyms:

• (5-Methyl-2-Phenyl-1,3-Oxazol-4-Yl)Acetic Acid
• 2-(5-Methyl-2-phenyloxazol-4-yl)acetic acid
• 2-Phenyl-5-methyloxazole-4-acetic acid
• 4-Oxazoleacetic acid, 5-methyl-2-phenyl-
• 5-Methyl-2-phenyl-4-oxazoleacetic acid
• 5-Methyl-2-phenyloxazol-4-ylacetic acid

(5-Methyl-2-phenyl-1,3-oxazol-4-yl)acetic acid

CAS: 107367-98-6

(5-Methyl-2-phenyl-1,3-oxazol-4-yl)acetic acid

Formula: C₁₂H₁₁NO₃

Purity: 95%

Color and Shape: Beige Solid

Molecular weight: 217.22064

Ref: 54-OR21964

2-(5-Methyl-2-phenyl-1,3-oxazol-4-yl)acetic acid

CAS: 107367-98-6

2-(5-Methyl-2-phenyl-1,3-oxazol-4-yl)acetic acid is a monoxide (CO) donor that is synthesized by the palladium catalyzed reaction of carbon monoxide and acetic acid. The CO molecule has a high degree of reactivity with many organic compounds and can be used to produce valuable chemicals. It also has been shown to be an effective catalyst for the synthesis of 2-(5-methyl-2-phenyloxazol-4-yl)acetic acid.

Formula: C₁₂H₁₁NO₃

Purity: Min. 95%

Molecular weight: 217.22 g/mol

Ref: 3D-HEA36798