CymitQuimica logo

CAS 1075-00-9

:

8-Fluoroisoquinoline

Description:
8-Fluoroisoquinoline is a heterocyclic aromatic compound characterized by the presence of a fluorine atom at the 8-position of the isoquinoline structure. Its molecular formula is C9H6F N, indicating it contains nine carbon atoms, six hydrogen atoms, one fluorine atom, and one nitrogen atom. This compound exhibits a fused bicyclic structure, which contributes to its aromatic properties and potential reactivity. 8-Fluoroisoquinoline is typically a pale yellow to light brown solid, and it is soluble in organic solvents such as ethanol and dichloromethane, but less soluble in water. The presence of the fluorine atom can influence its electronic properties, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, compounds like 8-fluoroisoquinoline are of interest in medicinal chemistry due to their potential biological activities, including antimicrobial and anticancer properties. Safety data indicates that, like many fluorinated compounds, it should be handled with care, as it may pose health risks upon exposure.
Formula:C9H6FN
InChI:InChI=1/C9H6FN/c10-9-3-1-2-7-4-5-11-6-8(7)9/h1-6H
InChI key:AAQUCBIWXJSBEU-UHFFFAOYSA-N
SMILES:c1cc2ccncc2c(c1)F
Synonyms:
  • Isoquinoline, 8-Fluoro-
Found 4 products.