CAS 107582-20-7
:Methyl 2,3-diaminobenzoate
Description:
Methyl 2,3-diaminobenzoate, with the CAS number 107582-20-7, is an organic compound characterized by its aromatic structure, featuring a benzene ring substituted with two amino groups and a methoxycarbonyl group. This compound typically appears as a solid or crystalline substance and is soluble in polar organic solvents. The presence of amino groups imparts basic properties, allowing it to participate in various chemical reactions, such as acylation and alkylation. Methyl 2,3-diaminobenzoate is often utilized in the synthesis of pharmaceuticals and agrochemicals due to its potential as an intermediate in the production of more complex molecules. Additionally, its structural features may confer biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, this compound exemplifies the diverse applications of amine-substituted aromatic compounds in chemical synthesis and research.
Formula:C8H10N2O2
InChI:InChI=1/C8H10N2O2/c1-12-8(11)5-3-2-4-6(9)7(5)10/h2-4H,9-10H2,1H3
SMILES:COC(=O)c1cccc(c1N)N
Synonyms:- 2,3-Diaminobenzoic acid methyl ester
- 2,3-Diamino Benzoicacid Methyl Ester
- 2,3-Diamino-benzoic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 2,3-Diaminobenzoate
CAS:Formula:C8H10N2O2Purity:>98.0%(GC)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:166.182,3-Diaminobenzoic acid methyl ester
CAS:Formula:C8H10N2O2Purity:97%Color and Shape:SolidMolecular weight:166.1772Methyl 2,3-diaminobenzoate
CAS:Methyl 2,3-diaminobenzoateFormula:C8H10N2O2Purity:98%Molecular weight:166.17722,3-Diaminobenzoic acid methyl ester
CAS:2,3-Diaminobenzoic acid methyl ester is a redox potential catalyst that has been shown to have anticancer activity in vitro and in vivo. It is a 5-ht4 receptor agonist, which causes an increase in the intracellular concentration of cAMP. The anticancer effect of this compound may be due to its ability to inhibit the growth of cancer cells by blocking DNA synthesis and cell division. The biological properties of this drug are not well understood, but it has been shown to have antioxidant effects, as well as proton-reducing and electron-accepting properties. This compound has also been studied electrochemically.Formula:C8H10N2O2Purity:95%NmrColor and Shape:PowderMolecular weight:166.18 g/mol2,3-Diaminobenzoic acid methyl ester
CAS:Formula:C8H10N2O2Purity:98%Color and Shape:SolidMolecular weight:166.18




