CymitQuimica logo

CAS 1076197-56-2

:

3,5-Dichloro-2-(chloromethyl)pyridine

Description:
3,5-Dichloro-2-(chloromethyl)pyridine is a chlorinated pyridine derivative characterized by the presence of two chlorine atoms at the 3 and 5 positions and a chloromethyl group at the 2 position of the pyridine ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its reactivity due to the presence of multiple halogen substituents, which can influence its behavior in chemical reactions, particularly in nucleophilic substitution and electrophilic aromatic substitution. The chloromethyl group enhances its potential as an intermediate in organic synthesis, allowing for further functionalization. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Safety precautions should be taken when handling this substance, as it may pose health risks due to its chlorinated nature. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety in laboratory settings.
Formula:C6H4Cl3N
InChI:InChI=1S/C6H4Cl3N/c7-2-6-5(9)1-4(8)3-10-6/h1,3H,2H2
InChI key:InChIKey=GKDLDSNZQXBKQC-UHFFFAOYSA-N
SMILES:C(Cl)C1=C(Cl)C=C(Cl)C=N1
Synonyms:
  • Pyridine, 3,5-dichloro-2-(chloromethyl)-
  • 3,5-Dichloro-2-(chloromethyl)pyridine
Found 3 products.