CymitQuimica logo

CAS 107818-55-3

:

methyl 3-amino-5-bromothiophene-2-carboxylate

Description:
Methyl 3-amino-5-bromothiophene-2-carboxylate is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features a bromine atom and an amino group at specific positions on the thiophene ring, contributing to its reactivity and potential applications in pharmaceuticals and agrochemicals. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification or amidation. Methyl 3-amino-5-bromothiophene-2-carboxylate is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure allows for hydrogen bonding due to the amino group, which can influence its physical properties and interactions with other molecules. The compound's unique combination of functional groups makes it a valuable intermediate in synthetic organic chemistry, particularly in the development of biologically active compounds. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks.
Formula:C6H6BrNO2S
InChI:InChI=1S/C6H6BrNO2S/c1-10-6(9)5-3(8)2-4(7)11-5/h2H,8H2,1H3
InChI key:RZYLOBBUEWSONL-UHFFFAOYSA-N
SMILES:COC(=O)c1c(cc(Br)s1)N
Synonyms:
  • 2-Thiophenecarboxylic acid,3-amino-5-bromo-,methyl ester
  • Methyl 3-amino-5-bromo-2-thiophenecarboxylate
Found 4 products.