CymitQuimica logo

CAS 1080-74-6

:

Dicyanomethyleneindianone; 98%

Description:
Dicyanomethyleneindianone, with the CAS number 1080-74-6, is an organic compound characterized by its distinctive structure, which includes a dicyanomethylene group attached to an indanone framework. This compound typically appears as a solid, often exhibiting a deep color due to its conjugated system, which can contribute to its potential applications in dyes and pigments. It is known for its reactivity, particularly in nucleophilic addition reactions, owing to the electron-withdrawing nature of the cyano groups. Dicyanomethyleneindianone is also recognized for its role in organic synthesis, particularly in the formation of various derivatives that can be utilized in pharmaceuticals and agrochemicals. The compound is generally handled with care due to its potential toxicity and the need for appropriate safety measures during use. Its purity, often stated as 98%, indicates a high level of refinement, making it suitable for research and industrial applications where precise chemical behavior is essential.
Formula:C12H6N2O
InChI:InChI=1/C12H6N2O/c13-6-8(7-14)11-5-12(15)10-4-2-1-3-9(10)11/h1-4H,5H2
InChI key:QNVKZKOSAXYVFZ-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)C(=C(C#N)C#N)CC2=O
Synonyms:
  • 3-(Dicyanomethylene)indian-1-one
  • (3-oxo-2,3-dihydro-1H-inden-1-ylidene)propanedinitrile
Found 5 products.