CAS 1081-15-8
:formaldehyde 2,4-dinitrophenylhydrazone
Description:
Formaldehyde 2,4-dinitrophenylhydrazone, with the CAS number 1081-15-8, is a chemical compound formed by the reaction of formaldehyde with 2,4-dinitrophenylhydrazine. This substance is typically characterized as a yellow crystalline solid, which is indicative of its hydrazone structure. It is primarily used in organic chemistry as a reagent for the qualitative and quantitative analysis of aldehydes and ketones, as it forms stable hydrazone derivatives. The compound is known for its relatively high melting point and solubility in organic solvents, making it suitable for various laboratory applications. Additionally, it exhibits moderate toxicity, necessitating appropriate safety precautions during handling. The presence of the dinitrophenyl group contributes to its reactivity and spectroscopic properties, allowing for effective detection and characterization of carbonyl compounds. Overall, formaldehyde 2,4-dinitrophenylhydrazone serves as a valuable tool in analytical chemistry, particularly in the study of carbonyl functionalities.
Formula:C7H6N4O4
InChI:InChI=1/C7H6N4O4/c1-8-9-6-3-2-5(10(12)13)4-7(6)11(14)15/h2-4,9H,1H2
SMILES:C=NNc1ccc(cc1N(=O)=O)N(=O)=O
Synonyms:- Formaldehyde, (2,4-dinitrophenyl)hydrazone
- Ai3-16294
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Formaldehyde 2,4-Dinitrophenylhydrazone
CAS:<p>Stability Shock Sensitive<br>Applications Formaldehyde 2,4-Dinitrophenylhydrazone is a dinitrophenylhydrazone (DNPH) derivative of an aliphatic aldehyde found in mainstream cigarette smoke.<br>References Delgado, B. et al.: J. Liq. Chrom. Rel. Technol., 31, 361 (2008); Miller, J.H. et al.: J. Chrom. Sci., 48, 12 (2010);<br></p>Formula:C7H6N4O4Color and Shape:NeatMolecular weight:210.15Formaldehyde 2,4-Dinitrophenylhydrazone-13C
CAS:Controlled Product<p>Stability Light Sensitive<br>Applications Isotope labelled Formaldehyde 2,4-Dinitrophenylhydrazone is a dinitrophenylhydrazone (DNPH) derivative of an aliphatic aldehyde found in mainstream cigarette smoke.<br>References Delgado, B. et al.: J. Liq. Chrom. Rel. Technol., 31, 361 (2008); Miller, J.H. et al.: J. Chrom. Sci., 48, 12 (2010);<br></p>Formula:C613CH6N4O4Color and Shape:NeatMolecular weight:211.14Formaldehyde 2,4-Dinitrophenylhydrazone-13C6
CAS:Controlled ProductFormula:C6CH6N4O4Color and Shape:NeatMolecular weight:216.103Formaldehyde-2,4-dinitrophenylhydrazone
CAS:<p>Formaldehyde-2,4-dinitrophenylhydrazone (FDNH) is a chemical compound that inhibits the production of galacturonic acid. It is used as an analytical method to measure the concentration of galacturonic acid in biological samples. FDNH reacts with galacturonic acid to form a diazonium salt and a hydrazone derivative. The diazonium salt can be measured by liquid chromatography, while the hydrazone derivative can be measured by gas chromatography. This test has been used to measure the concentration of galacturonic acid in plants, pharmaceutical drugs, and reaction products.</p>Formula:C7H6N4O4Purity:Min. 95%Molecular weight:210.15 g/mol





