CymitQuimica logo

CAS 1082041-35-7

:

1H-Indazole, 4-fluoro-5-nitro-

Description:
1H-Indazole, 4-fluoro-5-nitro- is a heterocyclic organic compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring. The presence of a fluorine atom at the 4-position and a nitro group at the 5-position introduces distinct electronic and steric properties, influencing its reactivity and potential applications. This compound typically exhibits moderate solubility in organic solvents and may show limited solubility in water due to its aromatic structure. The nitro group is known for its electron-withdrawing effects, which can enhance the compound's electrophilic character, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the fluorine atom can impart unique properties such as increased lipophilicity and altered biological activity. 1H-Indazole derivatives are of interest in medicinal chemistry for their potential pharmacological activities, including anti-inflammatory and anticancer properties. As with many nitro-containing compounds, care should be taken regarding their handling and disposal due to potential toxicity and environmental impact.
Formula:C7H4FN3O2
InChI:InChI=1S/C7H4FN3O2/c8-7-4-3-9-10-5(4)1-2-6(7)11(12)13/h1-3H,(H,9,10)
InChI key:InChIKey=KWAYHRXXJNBMRS-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC=C1N(=O)=O)NN=C2
Synonyms:
  • 1H-Indazole, 4-fluoro-5-nitro-
  • 4-Fluoro-5-nitro-1H-indazole
Found 3 products.