CAS 108238-41-1
:3,6-dihydroxyflavone
Description:
3,6-Dihydroxyflavone is a flavonoid compound characterized by the presence of two hydroxyl (-OH) groups located at the 3 and 6 positions of the flavone backbone. This structure contributes to its potential biological activities, including antioxidant, anti-inflammatory, and neuroprotective properties. The compound is typically found in various plant sources and may play a role in plant pigmentation and UV protection. Its solubility can vary depending on the solvent, with polar solvents generally enhancing its solubility due to the presence of hydroxyl groups. 3,6-Dihydroxyflavone has garnered interest in pharmacological research for its potential therapeutic applications, particularly in the context of neurodegenerative diseases and as a dietary supplement. Additionally, its ability to modulate various biochemical pathways makes it a subject of study in the field of natural products and medicinal chemistry. As with many flavonoids, its bioavailability and metabolic pathways are important considerations for its efficacy in biological systems.
Formula:C15H10O4
InChI:InChI=1/C15H10O4/c16-10-6-7-12-11(8-10)13(17)14(18)15(19-12)9-4-2-1-3-5-9/h1-8,16,18H
InChI key:InChIKey=XHLOLFKZCUCROE-UHFFFAOYSA-N
SMILES:OC1=C(OC=2C(C1=O)=CC(O)=CC2)C3=CC=CC=C3
Synonyms:- 3,6-Dihydroxy-2-phenyl-4H-1-benzopyran-4-one
- 3,6-Dihydroxy-2-phenylchromen-4-one
- 3,6-dihydroxy-2-phenyl-4H-chromen-4-one
- 4H-1-Benzopyran-4-one, 3,6-dihydroxy-2-phenyl-
- Flavone, 3,6-dihydroxy-
- 3,6-Dihydroxyflavone
- DIHYDROXYFLAVONE, 3,6-(RG)
- 3,6-Dihydroxy-2-phenylchromone
- inhibit,Inhibitor,caspase cascade,cell viability,oxidative stress,3,6-DHF,Apoptosis,PARP,lipid peroxidation,3,6 Dihydroxyflavone,3,6-Dihydroxyflavone,3,6Dihydroxyflavone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
3,6-Dihydroxyflavone
CAS:Formula:C15H10O4Purity:>98.0%(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:254.243,6-Dihydroxyflavone
CAS:3,6-Dihydroxyflavone analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C15H10O4Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:254.243,6-Dihydroxy-2-phenyl-4H-chromen-4-one
CAS:Formula:C15H10O4Purity:98%Color and Shape:SolidMolecular weight:254.23753,6-Dihydroxyflavone
CAS:3,6-Dihydroxyflavone suppresses the epithelial-mesenchymal transition in breast cancer cells by inhibiting the Notch signaling pathway.Formula:C15H10O4Purity:99.92%Color and Shape:SolidMolecular weight:254.243,6-Dihydroxyflavone
CAS:3,6-Dihydroxy-2-phenyl-4H-chromen-4-oneFormula:C15H10O4Purity:98%Molecular weight:254.243,6-Dihydroxyflavone
CAS:3,6-Dihydroxyflavone is a coumarin derivative that has been shown to have anti-inflammatory, antioxidant and anticancer properties. 3,6-Dihydroxyflavone can inhibit the enzyme activities of 5-lipoxygenase, cyclooxygenase and phospholipase A2 in the human serum. This compound also inhibits the production of nitric oxide by inhibiting the activation of inducible nitric oxide synthase (iNOS). 3,6-Dihydroxyflavone can reduce mitochondrial membrane potential and induce apoptosis in HL60 cells. It also induces cell death in breast cancer cells by inhibiting protein synthesis and inducing caspase-dependent apoptosis.Formula:C15H10O4Purity:Min. 95%Molecular weight:254.24 g/mol







