CymitQuimica logo

CAS 1082843-72-8

:

6-bromo-3-chloropyrazin-2-amine

Description:
6-Bromo-3-chloropyrazin-2-amine is a heterocyclic organic compound characterized by the presence of a pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at non-adjacent positions. The compound features a bromine atom at the 6-position and a chlorine atom at the 3-position of the pyrazine ring, along with an amino group (-NH2) at the 2-position. These substituents contribute to its chemical reactivity and potential applications in medicinal chemistry and material science. The presence of halogens (bromine and chlorine) can enhance the compound's biological activity and influence its solubility and stability. Additionally, the amino group can participate in hydrogen bonding and nucleophilic reactions, making the compound versatile in synthetic pathways. Its molecular structure suggests potential use in the development of pharmaceuticals, agrochemicals, or as a building block in organic synthesis. As with many halogenated compounds, considerations regarding environmental impact and toxicity are important in its handling and application.
Formula:C4H3BrClN3
InChI:InChI=1S/C4H3BrClN3/c5-2-1-8-3(6)4(7)9-2/h1H,(H2,7,9)
InChI key:LYMPGCBRUNBZJX-UHFFFAOYSA-N
SMILES:c1c(Br)nc(c(Cl)n1)N
Found 4 products.