CymitQuimica logo

CAS 108310-80-1

:

2-Hydrazinylthiazolo[5,4-c]pyridine

Description:
2-Hydrazinylthiazolo[5,4-c]pyridine is a heterocyclic compound characterized by the presence of both hydrazine and thiazole functional groups fused to a pyridine ring. This compound typically exhibits a range of chemical properties due to the presence of nitrogen atoms, which can participate in hydrogen bonding and coordination with metal ions. The thiazole moiety contributes to its potential biological activity, as thiazoles are known for their roles in pharmaceuticals and agrochemicals. The hydrazinyl group can also enhance reactivity, making it a candidate for various chemical transformations. In terms of solubility, compounds of this nature may exhibit moderate solubility in polar solvents, while their stability can be influenced by environmental factors such as pH and temperature. Additionally, 2-Hydrazinylthiazolo[5,4-c]pyridine may possess interesting electronic properties, making it a subject of interest in materials science and medicinal chemistry. Overall, its unique structure and functional groups suggest potential applications in drug development and synthetic chemistry.
Formula:C6H6N4S
InChI:InChI=1S/C6H6N4S/c7-10-6-9-4-1-2-8-3-5(4)11-6/h1-3H,7H2,(H,9,10)
InChI key:InChIKey=CBQJRAUFNPLLEF-UHFFFAOYSA-N
SMILES:N(N)=C1NC=2C(S1)=CN=CC2
Synonyms:
  • 2-(Hydrazino)thiazolo[5,4-c]pyridine
  • Thiazolo[5,4-c]pyridin-2(1H)-one, hydrazone
  • 2-Hydrazinylthiazolo[5,4-c]pyridine
  • [1,3]Thiazolo[5,4-c]pyridin-2-ylhydrazine
  • Thiazolo[5,4-c]pyridine, 2-hydrazinyl-
Found 1 products.