CymitQuimica logo

CAS 1083168-88-0

:

5-Bromo-1-[2-(methylsulfonyl)ethyl]-2(1H)-pyridinone

Description:
5-Bromo-1-[2-(methylsulfonyl)ethyl]-2(1H)-pyridinone is a chemical compound characterized by its pyridinone core, which features a bromine atom at the 5-position and a methylsulfonyl group attached to a 2-ethyl substituent. This structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the bromine atom can enhance the compound's reactivity and influence its pharmacokinetic properties. The methylsulfonyl group is known for its ability to improve solubility and stability, which can be advantageous in drug formulation. This compound may exhibit various properties, including antimicrobial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Additionally, its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in drug development. As with many organic compounds, safety and handling precautions should be observed due to the presence of halogens and sulfonyl groups, which can pose health risks.
Formula:C8H10BrNO3S
InChI:InChI=1S/C8H10BrNO3S/c1-14(12,13)5-4-10-6-7(9)2-3-8(10)11/h2-3,6H,4-5H2,1H3
InChI key:InChIKey=AGNQYMOWIBRFNN-UHFFFAOYSA-N
SMILES:C(CS(C)(=O)=O)N1C(=O)C=CC(Br)=C1
Synonyms:
  • 5-Bromo-1-[2-(methylsulfonyl)ethyl]-2(1H)-pyridinone
  • 2(1H)-Pyridinone, 5-bromo-1-[2-(methylsulfonyl)ethyl]-
Found 3 products.