CymitQuimica logo

CAS 108318-76-9

:

Methyl 2-(aminosulfonyl)-4-methoxybenzoate

Description:
Methyl 2-(aminosulfonyl)-4-methoxybenzoate, identified by its CAS number 108318-76-9, is an organic compound characterized by its sulfonamide functional group, which contributes to its potential biological activity. This compound features a methoxy group and a methyl ester, indicating it has both hydrophilic and lipophilic properties, which can influence its solubility and permeability in biological systems. The presence of the aminosulfonyl group suggests that it may exhibit properties relevant to medicinal chemistry, potentially acting as a sulfonamide antibiotic or having other therapeutic applications. Its molecular structure allows for various interactions with biological targets, making it of interest in drug development. Additionally, the compound's stability, reactivity, and potential toxicity would need to be evaluated in the context of its intended use. Overall, Methyl 2-(aminosulfonyl)-4-methoxybenzoate represents a class of compounds that may have significant implications in pharmaceuticals and biochemistry.
Formula:C9H11NO5S
InChI:InChI=1S/C9H11NO5S/c1-14-6-3-4-7(9(11)15-2)8(5-6)16(10,12)13/h3-5H,1-2H3,(H2,10,12,13)
InChI key:InChIKey=UVIZJKBQVSQJLG-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(S(N)(=O)=O)C=C(OC)C=C1
Synonyms:
  • Benzoic acid, 2-(aminosulfonyl)-4-methoxy-, methyl ester
  • Methyl 2-(aminosulfonyl)-4-methoxybenzoate
Found 1 products.