CymitQuimica logo

CAS 1083181-35-4

:

1-(2,4-bi(benzyloxy)-3,6-dihydroxyphenyl)ethanone

Description:
1-(2,4-bi(benzyloxy)-3,6-dihydroxyphenyl)ethanone, with the CAS number 1083181-35-4, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups. This compound features a phenolic framework, indicating the presence of hydroxyl (-OH) groups that contribute to its potential reactivity and solubility in polar solvents. The benzyloxy groups enhance its lipophilicity, which may influence its biological activity and interaction with cellular membranes. The ethanone moiety suggests that it may exhibit ketone-like properties, potentially participating in various chemical reactions such as nucleophilic additions. The presence of multiple hydroxyl groups can also indicate potential antioxidant properties, making it of interest in medicinal chemistry and materials science. Overall, this compound's unique structural features may lead to diverse applications, particularly in pharmaceuticals and organic synthesis, although specific biological activities and practical applications would require further investigation.
Formula:C22H20O5
InChI:InChI=1S/C22H20O5/c1-15(23)20-18(24)12-19(26-13-16-8-4-2-5-9-16)21(25)22(20)27-14-17-10-6-3-7-11-17/h2-12,24-25H,13-14H2,1H3
InChI key:LCOBNBPKWCKAKF-UHFFFAOYSA-N
SMILES:CC(=O)C1=C(C(=C(C=C1O)OCC2=CC=CC=C2)O)OCC3=CC=CC=C3
Found 2 products.