CymitQuimica logo

CAS 1083181-36-5

:

4-Bromo-2-cyanomethylbenzoic acid methyl ester

Description:
4-Bromo-2-cyanomethylbenzoic acid methyl ester is an organic compound characterized by its functional groups, which include a bromine atom, a cyano group, and an ester moiety. This compound features a benzoic acid structure with a methyl ester, indicating that it is a derivative of benzoic acid where the carboxylic acid is converted to a methyl ester. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and physical properties, such as solubility and boiling point. The cyano group (-C≡N) contributes to the compound's polarity and can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Typically, compounds like this may exhibit moderate to high stability under standard conditions, but their reactivity can vary based on the surrounding environment and the presence of other reagents. Additionally, the compound may have applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis due to its unique structural features.
Formula:C10H8BrNO2
InChI:InChI=1S/C10H8BrNO2/c1-14-10(13)9-3-2-8(11)6-7(9)4-5-12/h2-3,6H,4H2,1H3
InChI key:OXXCXDQCAGYFQM-UHFFFAOYSA-N
SMILES:COC(=O)C1=C(C=C(C=C1)Br)CC#N
Found 4 products.