CymitQuimica logo

CAS 1083224-23-0

:

5-(2,4-Difluorophenyl)isoxazole-3-carboxylic Acid

Description:
5-(2,4-Difluorophenyl)isoxazole-3-carboxylic acid is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of the 2,4-difluorophenyl group indicates that the compound has two fluorine substituents on the phenyl ring, which can significantly influence its chemical properties, such as polarity and reactivity. The carboxylic acid functional group (-COOH) contributes to its acidity and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of potential therapeutic agents. Its molecular structure suggests that it could participate in various chemical reactions, including esterification and amidation. Additionally, the fluorine atoms can enhance metabolic stability and alter the lipophilicity of the compound, which is crucial for drug design. Overall, 5-(2,4-Difluorophenyl)isoxazole-3-carboxylic acid is a versatile compound with potential applications in medicinal chemistry.
Formula:C10H5F2NO3
InChI:InChI=1S/C10H5F2NO3/c11-5-1-2-6(7(12)3-5)9-4-8(10(14)15)13-16-9/h1-4H,(H,14,15)
InChI key:FQAFQXBZWSTPRH-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1F)F)C2=CC(=NO2)C(=O)O
Synonyms:
  • 5-(2,4-difluorophenyl)-1,2-oxazole-3-carboxylic acid
  • 3-Isoxazolecarboxylic acid, 5-(2,4-difluorophenyl)-
Found 5 products.