CAS 108334-69-6
:Propanamide,2-amino-N,3-dihydroxy-N-(10-hydroxy-3-oxohexadecyl)- (9CI)
Description:
Propanamide, 2-amino-N,3-dihydroxy-N-(10-hydroxy-3-oxohexadecyl)-, commonly referred to by its CAS number 108334-69-6, is a chemical compound characterized by its amide functional group, which is indicative of its potential as a biological molecule. This compound features a long hydrocarbon chain, contributing to its hydrophobic properties, while the presence of hydroxyl groups suggests it may exhibit hydrogen bonding capabilities, enhancing its solubility in polar solvents. The amino group indicates that it can participate in various chemical reactions, including those typical of amino acids. Its structure suggests potential applications in pharmaceuticals or biochemistry, particularly in the development of surfactants or emulsifiers due to its amphiphilic nature. Additionally, the presence of multiple functional groups may allow for interactions with biological systems, making it of interest in medicinal chemistry. Overall, this compound's unique combination of hydrophobic and hydrophilic characteristics positions it as a versatile molecule in various chemical and biological applications.
Formula:C19H38N2O5
InChI:InChI=1S/C19H38N2O5/c1-2-3-4-7-10-16(23)11-8-5-6-9-12-17(24)13-14-21(26)19(25)18(20)15-22/h16,18,22-23,26H,2-15,20H2,1H3
InChI key:FRMSDVSQWDGNEK-UHFFFAOYSA-N
SMILES:CCCCCCC(CCCCCCC(=O)CCN(C(=O)C(CO)N)O)O
Synonyms:- NeoenactinM2
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Neoenactin M2
CAS:Neoenactin M2 exhibits strong antifungal activity against yeasts and filamentous fungi.Formula:C19H38N2O5Color and Shape:SolidMolecular weight:374.52
