CAS 108335-06-4
:Moscatin
Description:
Moscatin, with the CAS number 108335-06-4, is a naturally occurring compound primarily found in certain grape varieties and is known for its role in the aroma and flavor profile of wines. It belongs to a class of compounds known as terpenes, which are characterized by their strong fragrances and are often involved in plant defense mechanisms. Moscatin is particularly noted for its sweet, floral scent, contributing to the sensory attributes of muscat wines. The compound exhibits low toxicity and is generally recognized as safe for consumption in food products. Its chemical structure includes multiple double bonds, which contribute to its reactivity and interaction with other compounds in complex mixtures. Additionally, Moscatin may possess antioxidant properties, making it of interest in food science and potential health applications. Research into its specific biological activities and potential therapeutic benefits is ongoing, reflecting the broader interest in natural compounds derived from plants.
Formula:C15H12O3
InChI:InChI=1S/C15H12O3/c1-18-13-8-11(16)7-10-6-5-9-3-2-4-12(17)14(9)15(10)13/h2-8,16-17H,1H3
InChI key:InChIKey=LVOCAIKGDCMNNK-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C3C(=CC=C2C=C(O)C1)C=CC=C3O
Synonyms:- 2,5-Phenanthrenediol, 4-methoxy-
- 4-Methoxy-2,5-phenanthrenediol
- 4-Methoxyphenanthrene-2,5-Diol
- Plicatol B
- Moscatin
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Moscatin
CAS:Moscatin (Plicatol, 4-methoxyphenanthrene-2,5-diol) inhibits arachidonic acid-induced platelet aggregation, and inhibit Candida albicans virulence ERG, HSP, and ALS.Formula:C15H12O3Purity:99.89%Color and Shape:SolidMolecular weight:240.254Plicatol B
CAS:Plicatol B is a bioactive compound, which is a secondary metabolite isolated from natural sources, typically marine organisms or specific plant species. The primary source involves organisms that exhibit unique biochemical pathways, enabling the production of structurally distinct molecules like Plicatol B. Its mode of action involves interaction with cellular pathways, often targeting specific enzymatic processes or receptors, which can lead to varied biological effects depending on the system in question.
Formula:C15H12O3Purity:Min. 95%Molecular weight:240.26 g/mol





