CymitQuimica logo

CAS 1083396-48-8

:

2,1,3-Benzoxadiazole-5-acetic acid

Description:
2,1,3-Benzoxadiazole-5-acetic acid is an organic compound characterized by its benzoxadiazole core, which consists of a fused benzene and diazole ring system. This compound features an acetic acid functional group, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, which enhances its utility in various chemical applications. The presence of the benzoxadiazole moiety imparts interesting photophysical properties, making it a subject of interest in materials science, particularly in the development of fluorescent probes and sensors. Additionally, its structural features may confer biological activity, suggesting potential applications in pharmaceuticals or agrochemicals. The compound's reactivity can be influenced by the functional groups present, allowing for further derivatization and modification. Overall, 2,1,3-Benzoxadiazole-5-acetic acid is a versatile compound with significant implications in both research and industrial applications.
Formula:C8H6N2O3
InChI:InChI=1S/C8H6N2O3/c11-8(12)4-5-1-2-6-7(3-5)10-13-9-6/h1-3H,4H2,(H,11,12)
InChI key:InChIKey=PWNKVXVDVAOZMI-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=CC=2C(C=C1)=NON2
Synonyms:
  • 2-(2,1,3-Benzoxadiazol-5-yl)acetic acid
  • 2,1,3-Benzoxadiazole-5-acetic acid
Found 1 products.