CAS 108340-60-9
:Ganoderic acid D
Description:
Ganoderic acid D is a triterpenoid compound primarily derived from the Ganoderma lucidum mushroom, commonly known as reishi or lingzhi. This compound is part of a larger class of ganoderic acids, which are known for their diverse biological activities. Ganoderic acid D exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects. Its structure features multiple hydroxyl groups and a complex ring system, contributing to its biological activity and solubility characteristics. The compound has garnered interest in traditional medicine and modern pharmacology for its potential health benefits, including immune system modulation and liver protection. Additionally, research into ganoderic acids, including Ganoderic acid D, continues to explore their mechanisms of action and therapeutic applications, particularly in the context of chronic diseases. Overall, Ganoderic acid D represents a significant area of study within natural product chemistry and pharmacognosy, highlighting the importance of fungi in drug discovery and development.
Formula:C30H42O7
InChI:InChI=1S/C30H44O8/c1-14(10-16(31)11-15(2)26(37)38)17-12-21(34)30(7)22-18(32)13-19-27(3,4)20(33)8-9-28(19,5)23(22)24(35)25(36)29(17,30)6/h14-15,17-20,25,32-33,36H,8-13H2,1-7H3,(H,37,38)
InChI key:BPJPBLZKOVIJQD-UHFFFAOYSA-N
SMILES:CC(CC(=O)CC(C)C(=O)O)C1CC(=O)C2(C1(C(C(=O)C3=C2C(CC4C3(CCC(C4(C)C)O)C)O)O)C)C
Synonyms:- Lanost-8-en-26-oic acid, 7-hydroxy-3,11,15,23-tetraoxo-, (7β)-
- (7beta)-7-Hydroxy-3,11,15,23-tetraoxolanost-8-en-26-oic acid
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ganoderic acid D (Standard)
CAS:Ganoderic acid D (Standard) is a reference standard for research and analysis in studies involving Ganoderic acid D. 1. Ganoderic acid D is one of the major components in Ganoderma triterpenes. 2. Ganoderic acid D treatment for 48h inhibits the proliferation of HeLa human cervical carcinoma cells with an IC(5) value of 17.3 +/- .3 microM.Formula:C30H42O7Molecular weight:514.6503Ganoderic acid D
CAS:Ganoderic acid D (GD) is the major active triterpenoid in Ganoderma lucidum, a medicinal fungus used daily; biliary rather than renal clearance was the major route of excretion, the metabolic transformation included reduction, monohydroxylation, dihydroxylation, trihydroxylation, oxidation, desaturation, sulfation, and glucuronidation; the main metabolic soft spots in the chemical structure of GD were the 3-carbonyl group, angular methyl groups, the 7-hydroxy group, and the 26-carboxylic acid moiety.Formula:C30H42O7Purity:95%~99%Color and Shape:PowderMolecular weight:514.659Ganoderic acid D
CAS:Ganoderic acid D, a Ganoderma component, inhibits HeLa cell growth with an IC50 of 17.3µM after 48h.Formula:C30H42O7Purity:98.06% - 99.98%Color and Shape:White SolidMolecular weight:514.6503Ganoderic acid D
CAS:Carboxylic acid with additional oxygen functionsFormula:C30H42O7Purity:≥ 90.0 % (HPLC)Molecular weight:514.65Ganoderic acid D
CAS:Controlled ProductGanoderic acid D is a triterpenoid compound, which is bioactive and isolated from the medicinal mushroom Ganoderma lucidum, commonly known as reishi. This compound is a lanostane-type triterpenoid characterized by its complex biochemical structure, which plays an important role in the mushroom's pharmacological activities. The source, Ganoderma lucidum, has been utilized in traditional medicine, primarily in East Asia, for its diverse health benefits.Formula:C30H42O7Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:514.65 g/mol
