CymitQuimica logo

CAS 108354-38-7

:

4-bromo-1-(2-chloroethyl)-3-methyl-pyrazole

Description:
4-Bromo-1-(2-chloroethyl)-3-methyl-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a chloroethyl group at the 1-position contributes to its reactivity and potential applications in various chemical reactions. The methyl group at the 3-position adds to its structural complexity and influences its physical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique functional groups suggest potential uses in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. The presence of halogens (bromine and chlorine) can enhance biological activity and influence the compound's interaction with biological targets. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-bromo-1-(2-chloroethyl)-3-methyl-pyrazole is a compound of interest in synthetic organic chemistry and drug development.
Formula:C6H8BrClN2
InChI:InChI=1/C6H8BrClN2/c1-5-6(7)4-10(9-5)3-2-8/h4H,2-3H2,1H3
InChI key:URDUWHKZXWHRRS-UHFFFAOYSA-N
SMILES:Cc1c(cn(CCCl)n1)Br
Found 2 products.