CymitQuimica logo

CAS 108354-41-2

:

4-bromo-1-(2-chloroethyl)-5-methyl-pyrazole

Description:
4-Bromo-1-(2-chloroethyl)-5-methyl-pyrazole is an organic compound characterized by its pyrazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 4-position and a chloroethyl group at the 1-position contributes to its reactivity and potential applications in various chemical reactions. The methyl group at the 5-position enhances its lipophilicity, which may influence its biological activity. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and agrochemicals, due to its potential as a building block for more complex molecules. Its molecular structure suggests that it may exhibit interesting pharmacological properties, although specific biological activities would depend on further studies. As with many halogenated compounds, it is important to handle 4-bromo-1-(2-chloroethyl)-5-methyl-pyrazole with care, considering the environmental and health implications associated with halogenated organic substances.
Formula:C6H8BrClN2
InChI:InChI=1/C6H8BrClN2/c1-5-6(7)4-9-10(5)3-2-8/h4H,2-3H2,1H3
InChI key:KJCYVWIWEBDDBA-UHFFFAOYSA-N
SMILES:Cc1c(cnn1CCCl)Br
Found 1 products.