CymitQuimica logo

CAS 108357-63-7

:

Methanone, [4-(3-bromopropoxy)phenyl]phenyl-

Description:
Methanone, [4-(3-bromopropoxy)phenyl]phenyl- is an organic compound characterized by its ketone functional group, specifically a methanone structure where a phenyl group is substituted with a 4-(3-bromopropoxy)phenyl moiety. This compound features a brominated alkyl chain, which can influence its reactivity and solubility properties. The presence of the bromine atom typically enhances the compound's electrophilicity, making it more reactive in nucleophilic substitution reactions. Additionally, the ether-like propoxy group contributes to the compound's overall hydrophobic character, potentially affecting its interactions in biological systems or materials. The molecular structure suggests potential applications in organic synthesis, pharmaceuticals, or as a building block in materials science. As with many organic compounds, safety considerations should be taken into account, particularly regarding handling and disposal, due to the presence of bromine, which can be hazardous. Overall, the compound's unique structure and functional groups provide a basis for various chemical behaviors and applications.
Formula:C16H15BrO2
InChI:InChI=1S/C16H15BrO2/c17-11-4-12-19-15-9-7-14(8-10-15)16(18)13-5-2-1-3-6-13/h1-3,5-10H,4,11-12H2
InChI key:ZDNRXWREQFDOLK-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)OCCCBr
Found 3 products.