CymitQuimica logo

CAS 108373-05-3

:

3-BROMO-4-ETHOXYBENZALDEHYDE

Description:
3-Bromo-4-ethoxybenzaldehyde is an organic compound characterized by its aromatic structure, which includes a bromine substituent and an ethoxy group attached to a benzaldehyde moiety. The presence of the bromine atom introduces a degree of electrophilicity, making it a useful intermediate in various organic synthesis reactions. The ethoxy group enhances the solubility of the compound in organic solvents and can influence its reactivity. This compound typically appears as a pale yellow to light brown solid or liquid, depending on its purity and specific conditions. It is generally stable under standard laboratory conditions but should be handled with care due to the potential reactivity of the bromine atom. 3-Bromo-4-ethoxybenzaldehyde can be utilized in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals, owing to its functional groups that allow for further chemical modifications. As with many organic compounds, appropriate safety measures should be taken when handling this substance, including the use of personal protective equipment and working in a well-ventilated area.
Formula:C9H9BrO2
InChI:InChI=1S/C9H9BrO2/c1-2-12-9-4-3-7(6-11)5-8(9)10/h3-6H,2H2,1H3
InChI key:TZUUPGZANQRCHD-UHFFFAOYSA-N
SMILES:CCOC1=C(C=C(C=C1)C=O)Br
Found 6 products.