CymitQuimica logo

CAS 108391-82-8

:

D-Tryptophan, 6-fluoro-

Description:
D-Tryptophan, 6-fluoro- is a fluorinated derivative of the amino acid tryptophan, characterized by the presence of a fluorine atom at the 6-position of the indole ring. This modification can influence its biochemical properties, including its interaction with enzymes and receptors. The compound is typically classified as a non-polar amino acid due to its hydrophobic indole side chain, which can affect its solubility and reactivity in biological systems. D-Tryptophan, 6-fluoro- may exhibit altered pharmacological properties compared to its non-fluorinated counterpart, potentially impacting its role in neurotransmitter synthesis and metabolic pathways. The presence of the fluorine atom can enhance the compound's stability and lipophilicity, which may influence its bioavailability and distribution in living organisms. As with many fluorinated compounds, it may also exhibit unique interactions with biological targets, making it of interest in medicinal chemistry and drug design. However, specific applications and effects would depend on ongoing research and studies related to this compound.
Formula:C11H11FN2O2
InChI:InChI=1S/C11H11FN2O2/c12-7-1-2-8-6(3-9(13)11(15)16)5-14-10(8)4-7/h1-2,4-5,9,14H,3,13H2,(H,15,16)/t9-/m1/s1
InChI key:YMEXGEAJNZRQEH-SECBINFHSA-N
SMILES:C1=CC2=C(C=C1F)NC=C2C[C@H](C(=O)O)N
Synonyms:
  • (R)-2-amino-3-(6-fluoro-1H-indol-3-yl)propanoic acid
Found 3 products.