CymitQuimica logo

CAS 108391-99-7

:

5-thio-D-glucose 6-phosphate diammonium

Description:
5-Thio-D-glucose 6-phosphate diammonium is a chemical compound that serves as a derivative of glucose, specifically modified to include a thiol group and a phosphate group at the 6-position of the glucose molecule. This compound is characterized by its role in biochemical pathways, particularly in the context of carbohydrate metabolism and enzymatic reactions. The presence of the thiol group imparts unique reactivity, allowing it to participate in redox reactions and potentially serve as a substrate or inhibitor for various enzymes. The diammonium salt form indicates that it contains two ammonium ions, which can enhance its solubility in aqueous solutions, making it suitable for biological applications. Its CAS number, 108391-99-7, is a unique identifier that facilitates the identification and sourcing of this compound in scientific literature and databases. Overall, 5-thio-D-glucose 6-phosphate diammonium is of interest in research related to metabolic pathways, enzyme kinetics, and potential therapeutic applications.
Formula:C6H16NO8PS
InChI:InChI=1/C6H13O8PS.H3N/c7-3-2(1-14-15(11,12)13)16-6(10)5(9)4(3)8;/h2-10H,1H2,(H2,11,12,13);1H3
SMILES:C(C1C(C(C(C(O)S1)O)O)O)OP(=O)(O)O.N
Synonyms:
  • 6-O-phosphono-5-thiohexopyranose ammoniate
Found 3 products.