CymitQuimica logo

CAS 108397-75-7

:

5-Pyrimidinecarboxylic acid, 2,4,6-trimethyl- (9CI)

Description:
5-Pyrimidinecarboxylic acid, 2,4,6-trimethyl- is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. This compound features a carboxylic acid functional group (-COOH) at the 5-position of the pyrimidine ring, contributing to its acidity and reactivity. The presence of three methyl groups at the 2, 4, and 6 positions enhances its lipophilicity and may influence its biological activity. This compound is typically used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. The CAS number 108397-75-7 uniquely identifies this substance, facilitating its recognition in chemical databases and literature. As with many organic compounds, its physical properties, such as solubility and melting point, can vary based on environmental conditions and purity.
Formula:C8H10N2O2
InChI:InChI=1S/C8H10N2O2/c1-4-7(8(11)12)5(2)10-6(3)9-4/h1-3H3,(H,11,12)
InChI key:DRDANIHGQXLGSQ-UHFFFAOYSA-N
SMILES:CC1=C(C(=NC(=N1)C)C)C(=O)O
Found 3 products.