CymitQuimica logo

CAS 108412-04-0

:

D-2-Allylglycine hydrochloride

Description:
D-2-Allylglycine hydrochloride is a chemical compound that serves as a derivative of glycine, featuring an allyl group at the second carbon position. It is typically encountered as a white to off-white crystalline powder and is soluble in water, which facilitates its use in various biochemical applications. This compound is of interest in research, particularly in studies related to neurotransmitter systems and metabolic pathways, as it can act as an inhibitor of certain enzymes, such as those involved in the metabolism of amino acids. The hydrochloride form indicates that it is a salt, which often enhances its stability and solubility. D-2-Allylglycine hydrochloride is also utilized in the synthesis of other chemical entities and may have implications in pharmacological research. As with any chemical substance, proper handling and safety precautions are essential, given its potential biological activity.
Formula:C5H10ClNO2
InChI:InChI=1/C5H9NO2.ClH/c1-2-3-4(6)5(7)8;/h2,4H,1,3,6H2,(H,7,8);1H/t4-;/m1./s1
InChI key:DIDZZOWASZMNQW-PGMHMLKASA-N
SMILES:C=CC[C@H](C(=O)O)N.Cl
Synonyms:
  • 3-Vinyl-D-Alanine
  • N-prop-2-en-1-ylglycine hydrochloride (1:1)
Found 5 products.