CAS 108433-99-4
:magainin I
Description:
Magainin I is a peptide that is derived from the skin of the African clawed frog, Xenopus laevis. It is classified as an antimicrobial peptide, known for its ability to disrupt the membranes of bacteria, fungi, and some viruses, making it a subject of interest in antimicrobial research. The peptide consists of 23 amino acids and exhibits a positive charge, which contributes to its interaction with negatively charged microbial membranes. Magainin I is characterized by its amphipathic nature, possessing both hydrophilic and hydrophobic regions, allowing it to insert into lipid bilayers effectively. This property is crucial for its mechanism of action, which involves forming pores in microbial membranes, leading to cell lysis. Additionally, magainin I has been studied for its potential applications in medicine, particularly in developing new antibiotics and wound healing agents. Its stability and efficacy in various environments make it a valuable candidate for further research in the field of biochemistry and pharmacology.
Formula:C112H177N29O28S
InChI:InChI=1/C112H177N29O28S/c1-12-65(7)93(139-86(144)54-117)110(166)122-59-89(147)128-75(39-25-29-46-115)100(156)135-81(51-70-33-19-15-20-34-70)105(161)133-79(49-63(3)4)104(160)136-83(53-72-55-118-62-123-72)106(162)137-84(60-142)108(164)124-67(9)95(151)119-56-87(145)127-74(38-24-28-45-114)99(155)134-80(50-69-31-17-14-18-32-69)97(153)120-57-88(146)126-73(37-23-27-44-113)98(154)125-68(10)96(152)132-82(52-71-35-21-16-22-36-71)107(163)140-92(64(5)6)109(165)121-58-90(148)129-77(41-42-91(149)150)103(159)141-94(66(8)13-2)111(167)131-78(43-48-170-11)102(158)130-76(40-26-30-47-116)101(157)138-85(61-143)112(168)169/h14-22,31-36,55,62-68,73-85,92-94,142-143H,12-13,23-30,37-54,56-61,113-117H2,1-11H3,(H,118,123)(H,119,151)(H,120,153)(H,121,165)(H,122,166)(H,124,164)(H,125,154)(H,126,146)(H,127,145)(H,128,147)(H,129,148)(H,130,158)(H,131,167)(H,132,152)(H,133,161)(H,134,155)(H,135,156)(H,136,160)(H,137,162)(H,138,157)(H,139,144)(H,140,163)(H,141,159)(H,149,150)(H,168,169)/t65-,66-,67-,68-,73-,74-,75-,76-,77-,78-,79-,80-,81-,82-,83-,84-,85-,92-,93-,94-/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=NCC(=N[C@@H](CCCCN)C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](CC(C)C)C(=N[C@@H](Cc1cnc[nH]1)C(=N[C@@H](CO)C(=N[C@@H](C)C(=NCC(=N[C@@H](CCCCN)C(=N[C@@H](Cc1ccccc1)C(=NCC(=N[C@@H](CCCCN)C(=N[C@@H](C)C(=N[C@@H](Cc1ccccc1)C(=N[C@@H](C(C)C)C(=NCC(=N[C@@H](CCC(=O)O)C(=N[C@@H]([C@@H](C)CC)C(=N[C@@H](CCSC)C(=N[C@@H](CCCCN)C(=N[C@@H](CO)C(=O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)O)N=C(CN)O
Synonyms:- H-Gly-Ile-Gly-Lys-Phe-Leu-His-Ser-Ala-Gly-Lys-Phe-Gly-Lys-Ala-Phe-Val-Gly-Glu-Ile-Met-Lys-Ser-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Magainin I
CAS:Peptide, originally isolated from frog skin, with antimicrobial activity.Formula:C112H177N29O28SPurity:100%Color and Shape:White PowderMolecular weight:2409.88Magainin 1
CAS:Magainin 1 is an antimicrobial and amphipathic peptide isolated from the skin of Xenopus laevis.Formula:C112H177N29O28SPurity:98%Color and Shape:SolidMolecular weight:2409.85Magainin 1
CAS:Magainin 1 is a peptide antibiotic, which is sourced from the skin secretions of the African clawed frog, *Xenopus laevis*. It operates through a membranolytic mode of action, whereby it integrates into microbial cell membranes, forming pores and causing cell lysis by disrupting membrane integrity. This mechanism is largely non-specific, making it effective against a broad spectrum of bacteria and fungi.Formula:C112H177N29O28SPurity:Min. 95%Molecular weight:2,409.85 g/mol



