CymitQuimica logo

CAS 108446-77-1

:

1,3-Diphenyl-1H-pyrazole-4-propanoic acid

Description:
1,3-Diphenyl-1H-pyrazole-4-propanoic acid, with the CAS number 108446-77-1, is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. This compound features two phenyl groups attached to the pyrazole ring, contributing to its aromatic properties and potential for various interactions. The propanoic acid moiety indicates the presence of a carboxylic acid functional group, which can participate in hydrogen bonding and influence the compound's solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The presence of multiple aromatic rings often suggests potential for π-π stacking interactions, which can affect the compound's stability and interactions with biological targets. Additionally, the structural features may confer specific physicochemical properties, such as melting point, boiling point, and solubility in various solvents, which are essential for applications in drug formulation and development.
Formula:C18H16N2O2
InChI:InChI=1S/C18H16N2O2/c21-17(22)12-11-15-13-20(16-9-5-2-6-10-16)19-18(15)14-7-3-1-4-8-14/h1-10,13H,11-12H2,(H,21,22)
InChI key:InChIKey=LMHUSEBWZSOLAN-UHFFFAOYSA-N
SMILES:C(CC(O)=O)C=1C(=NN(C1)C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:
  • 1,3-Diphenyl-1H-pyrazole-4-propanoic acid
  • 1H-Pyrazole-4-propanoic acid, 1,3-diphenyl-
  • 3-(1,3-Diphenyl-1H-pyrazol-4-yl)propanoic acid
  • 3-(1,3-Diphenylpyrazol-4-Yl)Propanoic Acid
  • 1,3-Diphenylpyrazole-4-propionic acid
Found 1 products.