CymitQuimica logo

CAS 108475-89-4

:

Benzoic acid, 4-(hydroxyphenylmethyl)-, methyl ester

Description:
Benzoic acid, 4-(hydroxyphenylmethyl)-, methyl ester, also known as methyl 4-(hydroxybenzyl)benzoate, is an organic compound characterized by its ester functional group, which is derived from benzoic acid and a hydroxyphenylmethyl moiety. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. It exhibits properties associated with both benzoic acid and phenolic compounds, including potential antioxidant and antimicrobial activities. The presence of the hydroxy group enhances its reactivity and may influence its biological activity. This compound is of interest in various fields, including pharmaceuticals and materials science, due to its potential applications in drug formulation and as a chemical intermediate. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C15H14O3
InChI:InChI=1S/C15H14O3/c1-18-15(17)13-9-7-12(8-10-13)14(16)11-5-3-2-4-6-11/h2-10,14,16H,1H3
InChI key:ZNBIZPXNJOMSFQ-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC=C(C=C1)C(C2=CC=CC=C2)O
Found 4 products.