CymitQuimica logo

CAS 108481-92-1

:

2-Amino-4-(4-isopropylphenyl)- thiazole

Description:
2-Amino-4-(4-isopropylphenyl)thiazole is an organic compound characterized by the presence of both an amino group and a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an isopropylphenyl substituent, contributing to its hydrophobic characteristics and potentially influencing its biological activity. The thiazole moiety is known for its role in various biological systems and can exhibit antimicrobial, antifungal, and anticancer properties. The presence of the amino group suggests that it may participate in hydrogen bonding, enhancing its solubility in polar solvents. Additionally, the compound's structure may allow for interactions with biological targets, making it of interest in medicinal chemistry. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 2-Amino-4-(4-isopropylphenyl)thiazole represents a class of compounds that could have significant applications in pharmaceuticals and agrochemicals.
Formula:C12H14N2S
InChI:InChI=1/C12H14N2S/c1-8(2)9-3-5-10(6-4-9)11-7-15-12(13)14-11/h3-8H,1-2H3,(H2,13,14)
InChI key:UFBAQAAATDLTAZ-UHFFFAOYSA-N
SMILES:CC(C)c1ccc(cc1)c1csc(=N)[nH]1
Synonyms:
  • 4-[4-(1-Methylethyl)Phenyl)-2-Thiazolamine
  • 4-(4-Propan-2-Ylphenyl)-1,3-Thiazol-2-Amine
Found 4 products.