CymitQuimica logo

CAS 108512-04-5

:

4-Isoxazolamine, 3-methyl-, hydrochloride (1:1)

Description:
4-Isoxazolamine, 3-methyl-, hydrochloride (1:1) is a chemical compound characterized by its isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance typically appears as a white to off-white crystalline powder and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The compound is known for its potential biological activity, often studied in the context of medicinal chemistry for its pharmacological properties. Its molecular structure includes a methyl group at the 3-position of the isoxazole ring, which can influence its reactivity and interaction with biological targets. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the specific effects and safety profile can vary based on concentration and exposure. Overall, 4-Isoxazolamine, 3-methyl-, hydrochloride is of interest in various fields, including pharmaceuticals and organic synthesis.
Formula:C4H6N2O·ClH
InChI:InChI=1S/C4H6N2O.ClH/c1-3-4(5)2-7-6-3;/h2H,5H2,1H3;1H
InChI key:InChIKey=MSYIPTBDNXLQNW-UHFFFAOYSA-N
SMILES:NC=1C(C)=NOC1.Cl
Synonyms:
  • 4-Isoxazolamine, 3-methyl-, monohydrochloride
  • 4-Isoxazolamine, 3-methyl-, hydrochloride (1:1)
  • 3-Methylisoxazol-4-amine hydrochloride
Found 2 products.