CAS 108524-94-3
:Ilexgenin A
Description:
Ilexgenin A is a natural compound classified as a triterpenoid saponin, primarily derived from the Ilex genus, particularly Ilex paraguariensis, commonly known as yerba mate. This compound is characterized by its complex structure, which includes a steroid-like backbone and various functional groups that contribute to its biological activity. Ilexgenin A exhibits a range of pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer effects, making it of interest in medicinal chemistry and pharmacology. Its mechanism of action often involves modulation of cellular signaling pathways, which can influence cell proliferation and apoptosis. Additionally, Ilexgenin A's solubility and stability in different solvents can vary, impacting its bioavailability and efficacy in therapeutic applications. Research continues to explore its potential benefits and applications in health and wellness, particularly in traditional medicine contexts. As with many natural products, the extraction and purification processes are crucial for obtaining Ilexgenin A in a form suitable for further study and application.
Formula:C30H46O6
InChI:InChI=1S/C30H46O6/c1-17-9-14-30(24(34)35)16-15-26(3)18(22(30)29(17,6)36)7-8-19-25(2)12-11-21(31)28(5,23(32)33)20(25)10-13-27(19,26)4/h7,17,19-22,31,36H,8-16H2,1-6H3,(H,32,33)(H,34,35)/t17-,19-,20-,21+,22-,25-,26-,27-,28-,29-,30+/m1/s1
InChI key:InChIKey=UIEGOKVPCRANSU-XUFMHOFVSA-N
SMILES:C[C@]12C([C@]3([C@@](C(O)=O)(CC1)CC[C@@H](C)[C@@]3(C)O)[H])=CC[C@]4([C@@]2(C)CC[C@@]5([C@]4(C)CC[C@H](O)[C@@]5(C(O)=O)C)[H])[H]
Synonyms:- (3β,4β)-3,19-Dihydroxyurs-12-ene-23,28-dioic acid
- Ilexgenin A
- IlexgeninA
- Ilicin A
- Llexgenin A
- Myriaboric acid
- Urs-12-ene-23,28-dioic acid, 3,19-dihydroxy-, (3β,4β)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ilexgenin A
CAS:Ilexgenin A is a novel pentacyclic triterpenoid, is a compound extracted from leaves of Ilex hainanensis MerrFormula:C30H46O6Purity:97.11% - 97.19%Color and Shape:SolidMolecular weight:502.68Ref: TM-T2S0501
1mg66.00€5mg144.00€1mL*10mM (DMSO)177.00€10mg215.00€25mg326.00€50mg485.00€100mg690.00€Ilexgenin A
CAS:Controlled ProductIlexgenin A is a naturally occurring triterpenoid saponin, which is isolated from the leaves of Ilex pubescens and other species of the Ilex genus. It is characterized by its complex molecular structure, which contributes to its biological activities. The mode of action of Ilexgenin A primarily involves modulation of inflammatory pathways, where it acts as an inhibitor of key pro-inflammatory mediators such as NF-κB and cytokines. This compound effectively reduces inflammation by attenuating the signaling pathways that lead to the production of these mediators.Formula:C30H46O6Purity:Min. 95%Color and Shape:PowderMolecular weight:502.68 g/mol




