CAS 108543-82-4
:Z-Val-Met-OH
Description:
Z-Val-Met-OH, also known as Z-Valine-Methionine alcohol, is a synthetic compound that belongs to the class of amino acids and their derivatives. It features a Z (benzyloxycarbonyl) protecting group on the valine residue, which is commonly used in peptide synthesis to protect the amino group during chemical reactions. The presence of methionine contributes to its properties, as methionine is a sulfur-containing amino acid essential for various biological functions. Z-Val-Met-OH is typically utilized in peptide synthesis and research applications, particularly in the development of pharmaceuticals and biologically active compounds. Its structure allows for specific interactions in biological systems, making it valuable in medicinal chemistry. The compound is generally stable under standard laboratory conditions but should be handled with care, as with all chemical substances, to avoid any potential hazards. As with any amino acid derivative, its solubility and reactivity can vary depending on the solvent and conditions used in experiments.
Formula:C18H26N2O5S
InChI:InChI=1S/C18H26N2O5S/c1-12(2)15(16(21)19-14(17(22)23)9-10-26-3)20-18(24)25-11-13-7-5-4-6-8-13/h4-8,12,14-15H,9-11H2,1-3H3,(H,19,21)(H,20,24)(H,22,23)/t14-,15-/m0/s1
InChI key:WNRHCSDFQVZROA-GJZGRUSLSA-N
SMILES:CC(C)[C@@H](C(=O)N[C@@H](CCSC)C(=O)O)NC(=O)OCC1=CC=CC=C1
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
((Benzyloxy)carbonyl)-L-valyl-L-methionine
CAS:((Benzyloxy)carbonyl)-L-valyl-L-methionineFormula:C18H26N2O5SPurity:97%Molecular weight:382.48((Benzyloxy)carbonyl)-L-valyl-L-methionine
CAS:Formula:C18H26N2O5SPurity:98%Molecular weight:382.4744Z-Val-Met-OH
CAS:Z-Val-Met-OH is a high purity synthetic compound that can be used as a research tool in cell biology, ion channels and peptides. This compound is an activator of the receptor for bradykinin and has been shown to inhibit the activity of protein kinase C. Z-Val-Met-OH is also a ligand for the acetylcholine receptor and has been shown to inhibit acetylcholinesterase, leading to an increase in acetylcholine levels. Z-Val-Met-OH binds to the receptor for insulin and can be used as an inhibitor of insulin release from pancreatic beta cells.
Formula:C18H26N2O5SPurity:Min. 95%Molecular weight:382.48 g/molZ-VAL-MET-OH
CAS:Controlled ProductApplications Z-VAL-MET-OH (cas# 108543-82-4) is a useful research chemical.
Formula:C18H26N2O5SColor and Shape:NeatMolecular weight:382.474





