CymitQuimica logo

CAS 108551-59-3

:

5-Ethyl-2,3-dihydro-7-benzofurancarboxylic acid

Description:
5-Ethyl-2,3-dihydro-7-benzofurancarboxylic acid is an organic compound characterized by its unique bicyclic structure, which includes a benzofuran moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the ethyl group enhances its hydrophobic characteristics, influencing its solubility and reactivity. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and pharmacology. The molecular structure suggests potential interactions with biological targets, which could lead to various applications in drug development. Additionally, the compound's stability and reactivity can be influenced by factors such as pH and temperature. As with many organic acids, it may participate in acid-base reactions and could serve as a precursor in synthetic pathways. Overall, 5-Ethyl-2,3-dihydro-7-benzofurancarboxylic acid represents a class of compounds that are valuable for their structural diversity and potential utility in various chemical and biological contexts.
Formula:C11H12O3
InChI:InChI=1S/C11H12O3/c1-2-7-5-8-3-4-14-10(8)9(6-7)11(12)13/h5-6H,2-4H2,1H3,(H,12,13)
InChI key:InChIKey=CBEHCCOHAWHFCL-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(=CC(CC)=C1)CCO2
Synonyms:
  • 7-Benzofurancarboxylic acid, 5-ethyl-2,3-dihydro-
  • 5-Ethyl-2,3-dihydro-7-benzofurancarboxylic acid
Found 1 products.