CymitQuimica logo

CAS 108561-87-1

:

12-OXO-6,7,8,9,10,12-HEXAHYDRO-AZEPINO[2,1-B]QUINAZOLINE-3-CARBOXYLIC ACID

Description:
12-Oxo-6,7,8,9,10,12-hexahydro-azepino[2,1-b]quinazoline-3-carboxylic acid is a complex organic compound characterized by its unique bicyclic structure, which incorporates both azepine and quinazoline moieties. This compound features a carboxylic acid functional group, contributing to its acidic properties and potential reactivity. The presence of the oxo group indicates a ketone functionality, which can influence the compound's reactivity and stability. Its hexahydro configuration suggests that it is saturated, which may affect its solubility and interaction with biological systems. The compound's structural complexity may confer specific biological activities, making it of interest in medicinal chemistry and drug development. Additionally, the presence of multiple rings and functional groups can lead to diverse chemical behavior, including potential interactions with various biological targets. Overall, this compound exemplifies the intricate nature of organic molecules and their potential applications in pharmaceuticals and other fields.
Formula:C14H14N2O3
InChI:InChI=1/C14H14N2O3/c17-13-10-6-5-9(14(18)19)8-11(10)15-12-4-2-1-3-7-16(12)13/h5-6,8H,1-4,7H2,(H,18,19)
SMILES:C1CCc2nc3cc(ccc3c(=O)n2CC1)C(=O)O
Synonyms:
  • 12-Oxo-6,7,8,9,10,12-Hexahydroazepino[2,1-B]Quinazoline-3-Carboxylate
Found 2 products.