CymitQuimica logo

CAS 1086378-32-6

:

1h-indazole, 3-bromo-5-(trifluoromethyl)-

Description:
1H-Indazole, 3-bromo-5-(trifluoromethyl)- is a heterocyclic organic compound characterized by its indazole core, which consists of a fused benzene and pyrazole ring. The presence of a bromine atom at the 3-position and a trifluoromethyl group at the 5-position significantly influences its chemical properties and reactivity. This compound is typically a solid at room temperature and exhibits moderate solubility in organic solvents. The trifluoromethyl group is known for imparting unique electronic properties, enhancing lipophilicity, and influencing biological activity. The bromine substituent can participate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. Due to its structural features, this compound may be of interest in medicinal chemistry and material science, particularly in the development of pharmaceuticals or agrochemicals. Its CAS number, 1086378-32-6, allows for precise identification in chemical databases and literature. Overall, 1H-Indazole, 3-bromo-5-(trifluoromethyl)- is a versatile compound with potential applications in various fields of research.
Formula:C8H4BrF3N2
InChI:InChI=1S/C8H4BrF3N2/c9-7-5-3-4(8(10,11)12)1-2-6(5)13-14-7/h1-3H,(H,13,14)
InChI key:NJWMXXMBNBUURG-UHFFFAOYSA-N
SMILES:C1=CC2=NNC(=C2C=C1C(F)(F)F)Br
Found 4 products.