CAS 1086380-07-5
:4-Thiazolecarboxylicacid, 2-(methoxymethyl)-
Description:
4-Thiazolecarboxylic acid, 2-(methoxymethyl)- is an organic compound characterized by the presence of a thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties, and a methoxymethyl substituent that enhances its solubility and reactivity. The thiazole moiety is known for its biological activity, often serving as a scaffold in medicinal chemistry. The presence of the methoxymethyl group may influence the compound's lipophilicity and potential interactions with biological targets. Additionally, the compound's structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 4-Thiazolecarboxylic acid, 2-(methoxymethyl)- represents a versatile compound with potential utility in various chemical and biological applications.
Formula:C6H7NO3S
InChI:InChI=1S/C6H7NO3S/c1-10-2-5-7-4(3-11-5)6(8)9/h3H,2H2,1H3,(H,8,9)
InChI key:PIAYLONXKHUMGZ-UHFFFAOYSA-N
SMILES:COCC1=NC(=CS1)C(=O)O
Synonyms:- 2-(Methoxymethyl)Thiazole-4-Carboxylic Acid
- 2-(Methoxymethyl)-1,3-Thiazole-4-Carboxylic Acid
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
