CymitQuimica logo

CAS 1086381-30-7

:

4-Bromo-2-(1,1-dimethylethyl)pyridine

Description:
4-Bromo-2-(1,1-dimethylethyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a tert-butyl group at the 2-position significantly influences its chemical properties and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate polarity, which allows it to dissolve in various organic solvents while being less soluble in water. The bromine substituent can participate in electrophilic aromatic substitution reactions, while the tert-butyl group provides steric hindrance, affecting the compound's reactivity. Additionally, 4-Bromo-2-(1,1-dimethylethyl)pyridine may exhibit biological activity, making it of interest in medicinal chemistry and agrochemicals. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, this compound serves as a valuable intermediate in organic synthesis and research applications.
Formula:C9H12BrN
InChI:InChI=1S/C9H12BrN/c1-9(2,3)8-6-7(10)4-5-11-8/h4-6H,1-3H3
InChI key:InChIKey=TYDNNSUVMFKJJQ-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C1=CC(Br)=CC=N1
Synonyms:
  • Pyridine, 4-bromo-2-(1,1-dimethylethyl)-
  • 4-Bromo-2-(1,1-dimethylethyl)pyridine
Found 4 products.