CymitQuimica logo

CAS 1086381-36-3

:

4-Bromo-2-(1,1-dimethylethoxy)pyridine

Description:
4-Bromo-2-(1,1-dimethylethoxy)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a bulky 1,1-dimethylethoxy group at the 2-position contributes to its unique chemical properties. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its structure suggests potential for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of the bromine atom and the steric hindrance introduced by the dimethylethoxy group. The compound's solubility and reactivity can be influenced by the presence of the bromine and the ether functional group, making it a versatile building block in synthetic chemistry. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.
Formula:C9H12BrNO
InChI:InChI=1S/C9H12BrNO/c1-9(2,3)12-8-6-7(10)4-5-11-8/h4-6H,1-3H3
InChI key:InChIKey=NCDASAXVWHEWJS-UHFFFAOYSA-N
SMILES:O(C(C)(C)C)C1=CC(Br)=CC=N1
Synonyms:
  • Pyridine, 4-bromo-2-(1,1-dimethylethoxy)-
  • 4-Bromo-2-(1,1-dimethylethoxy)pyridine
Found 4 products.