CymitQuimica logo

CAS 1086382-13-9

:

4-Bromo-6-cyclopropylpyrimidine

Description:
4-Bromo-6-cyclopropylpyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with a bromine atom at the 4-position and a cyclopropyl group at the 6-position. This compound features a six-membered aromatic ring containing two nitrogen atoms, which contributes to its basicity and potential reactivity. The presence of the bromine substituent can enhance the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The cyclopropyl group introduces strain and unique steric properties, which can influence the compound's reactivity and interactions with biological targets. 4-Bromo-6-cyclopropylpyrimidine may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its solubility and stability in different solvents can vary, affecting its application in synthesis and biological assays. Overall, this compound represents a valuable structure in the field of organic synthesis and drug development, with potential applications in various chemical and pharmaceutical contexts.
Formula:C7H7BrN2
InChI:InChI=1S/C7H7BrN2/c8-7-3-6(5-1-2-5)9-4-10-7/h3-5H,1-2H2
InChI key:InChIKey=LBXBWLSNKFROFV-UHFFFAOYSA-N
SMILES:BrC1=CC(=NC=N1)C2CC2
Synonyms:
  • Pyrimidine, 4-bromo-6-cyclopropyl-
  • 4-Bromo-6-cyclopropylpyrimidine
Found 4 products.