CymitQuimica logo

CAS 1086382-60-6

:

5-Bromo-2-ethoxythiazole

Description:
5-Bromo-2-ethoxythiazole is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The compound features a bromine substituent at the 5-position and an ethoxy group at the 2-position of the thiazole ring. This structure contributes to its unique chemical properties, including potential reactivity and solubility characteristics. The presence of the bromine atom can enhance the compound's electrophilic nature, making it useful in various chemical reactions, including nucleophilic substitutions. The ethoxy group can influence the compound's polarity and solubility in organic solvents. 5-Bromo-2-ethoxythiazole may have applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. As with many thiazole derivatives, it may exhibit biological activity, which warrants further investigation for potential therapeutic uses. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C5H6BrNOS
InChI:InChI=1S/C5H6BrNOS/c1-2-8-5-7-3-4(6)9-5/h3H,2H2,1H3
InChI key:InChIKey=CTPYJNYAHWOZSV-UHFFFAOYSA-N
SMILES:O(CC)C=1SC(Br)=CN1
Synonyms:
  • Thiazole, 5-bromo-2-ethoxy-
  • 5-Bromo-2-ethoxythiazole
Found 2 products.