CymitQuimica logo

CAS 1086386-40-4

:

Methyl 2,3,4,7-tetrahydro-1,3-dimethyl-7-(2-methylpropyl)-2,4-dioxo-1H-pyrrolo[2,3-d]pyrimidine-6-carboxylate

Description:
Methyl 2,3,4,7-tetrahydro-1,3-dimethyl-7-(2-methylpropyl)-2,4-dioxo-1H-pyrrolo[2,3-d]pyrimidine-6-carboxylate, identified by CAS number 1086386-40-4, is a complex organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine moieties. This compound features multiple functional groups, including carboxylate and diketone functionalities, contributing to its potential reactivity and biological activity. The presence of methyl and isopropyl substituents suggests that it may exhibit lipophilic properties, influencing its solubility and interaction with biological membranes. The compound's structural complexity may also indicate potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization would typically involve advanced organic chemistry techniques, and its stability, reactivity, and potential toxicity would need to be evaluated through rigorous testing. Overall, this compound represents a fascinating example of synthetic organic chemistry with potential implications in drug discovery and development.
Formula:C14H19N3O4
InChI:InChI=1S/C14H19N3O4/c1-8(2)7-17-10(13(19)21-5)6-9-11(17)15(3)14(20)16(4)12(9)18/h6,8H,7H2,1-5H3
InChI key:InChIKey=VYVCRUYRIHVRNG-UHFFFAOYSA-N
SMILES:C(C(C)C)N1C2=C(C=C1C(OC)=O)C(=O)N(C)C(=O)N2C
Synonyms:
  • Methyl 2,3,4,7-tetrahydro-1,3-dimethyl-7-(2-methylpropyl)-2,4-dioxo-1H-pyrrolo[2,3-d]pyrimidine-6-carboxylate
  • 1H-Pyrrolo[2,3-d]pyrimidine-6-carboxylic acid, 2,3,4,7-tetrahydro-1,3-dimethyl-7-(2-methylpropyl)-2,4-dioxo-, methyl ester
Found 3 products.