CymitQuimica logo

CAS 1086386-51-7

:

4H-Pyrido[1,2-a]thieno[2,3-d]pyrimidine-2-carboxylicacid, 7-methyl-4-oxo-, methyl ester

Description:
4H-Pyrido[1,2-a]thieno[2,3-d]pyrimidine-2-carboxylic acid, 7-methyl-4-oxo-, methyl ester, identified by CAS number 1086386-51-7, is a heterocyclic compound characterized by its complex fused ring structure, which incorporates both pyridine and thieno-pyrimidine moieties. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of a carboxylic acid and a methyl ester functional group suggests it may participate in various chemical reactions, including esterification and hydrolysis. Its structural features may contribute to specific interactions with biological targets, potentially influencing its pharmacological profile. Additionally, the methyl group at the 7-position can affect the compound's lipophilicity and overall reactivity. As with many heterocycles, the compound may exhibit unique electronic properties due to the conjugation within its aromatic systems, which can be relevant for its chemical behavior and applications in medicinal chemistry.
Formula:C13H10N2O3S
InChI:InChI=1S/C13H10N2O3S/c1-7-3-4-10-14-11-8(12(16)15(10)6-7)5-9(19-11)13(17)18-2/h3-6H,1-2H3
InChI key:JILYVPYOCRWJFR-UHFFFAOYSA-N
SMILES:CC1=CN2C(=NC3=C(C2=O)C=C(S3)C(=O)OC)C=C1
Found 3 products.