CymitQuimica logo

CAS 1086391-97-0

:

4-(Tetrahydro-2H-pyran-4-yl)benzoic acid

Description:
4-(Tetrahydro-2H-pyran-4-yl)benzoic acid is an organic compound characterized by its unique structure, which includes a benzoic acid moiety and a tetrahydro-2H-pyran ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the carboxylic acid functional group (-COOH) suggests that it can participate in acid-base reactions and may act as a hydrogen bond donor. The tetrahydro-2H-pyran ring adds a degree of cyclic stability and can influence the compound's overall polarity and solubility in various solvents. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure allows for potential interactions with biological targets, which could be explored in drug development. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by environmental conditions such as pH and temperature.
Formula:C12H14O3
InChI:InChI=1S/C12H14O3/c13-12(14)11-3-1-9(2-4-11)10-5-7-15-8-6-10/h1-4,10H,5-8H2,(H,13,14)
InChI key:InChIKey=UOTCSFXNJIBLLZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC=C(C=C1)C2CCOCC2
Synonyms:
  • 4-(Tetrahydro-2H-pyran-4-yl)benzoic acid
  • Benzoic acid, 4-(tetrahydro-2H-pyran-4-yl)-
Found 4 products.