CymitQuimica logo

CAS 1086392-24-6

:

1,1-Dimethylethyl 3-(aminomethyl)-2,3-dihydro-1H-indole-1-carboxylate

Description:
1,1-Dimethylethyl 3-(aminomethyl)-2,3-dihydro-1H-indole-1-carboxylate, with the CAS number 1086392-24-6, is a chemical compound that features a complex structure characterized by an indole moiety, which is a bicyclic structure containing a benzene ring fused to a pyrrole ring. This compound includes an ester functional group, indicated by the "carboxylate" portion, which suggests it may exhibit properties typical of esters, such as volatility and solubility in organic solvents. The presence of the aminomethyl group indicates potential for hydrogen bonding and reactivity, making it a candidate for various chemical reactions. Additionally, the dimethyl group contributes to steric hindrance, which can influence the compound's reactivity and interaction with biological systems. Overall, this compound may possess interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C14H20N2O2
InChI:InChI=1S/C14H20N2O2/c1-14(2,3)18-13(17)16-9-10(8-15)11-6-4-5-7-12(11)16/h4-7,10H,8-9,15H2,1-3H3
InChI key:InChIKey=FLRGVFQWIPNTAJ-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(C(CN)C1)=CC=CC2
Synonyms:
  • 1H-Indole-1-carboxylic acid, 3-(aminomethyl)-2,3-dihydro-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 3-(aminomethyl)-2,3-dihydro-1H-indole-1-carboxylate
Found 3 products.