CymitQuimica logo

CAS 1086392-26-8

:

1,1-Dimethylethyl 6-(aminomethyl)-2,3-dihydro-1H-indole-1-carboxylate

Description:
1,1-Dimethylethyl 6-(aminomethyl)-2,3-dihydro-1H-indole-1-carboxylate, with the CAS number 1086392-26-8, is a chemical compound that features a complex structure characterized by an indole ring system. This compound contains a carboxylate functional group, which contributes to its potential reactivity and solubility in various solvents. The presence of the aminomethyl group suggests that it may participate in various chemical reactions, including those involving amine functionalities. The dimethyl substituents on the tert-butyl group enhance the steric bulk around the molecule, potentially influencing its biological activity and interactions. This compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for drug design or development. Additionally, its unique combination of functional groups may impart specific properties, such as lipophilicity or hydrogen bonding capabilities, which are critical in determining its behavior in biological systems. Further studies would be necessary to elucidate its specific applications and biological activities.
Formula:C14H20N2O2
InChI:InChI=1S/C14H20N2O2/c1-14(2,3)18-13(17)16-7-6-11-5-4-10(9-15)8-12(11)16/h4-5,8H,6-7,9,15H2,1-3H3
InChI key:InChIKey=WWKXEECKCJDNGY-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C=2C(=CC=C(CN)C2)CC1
Synonyms:
  • 1,1-Dimethylethyl 6-(aminomethyl)-2,3-dihydro-1H-indole-1-carboxylate
  • 1H-Indole-1-carboxylic acid, 6-(aminomethyl)-2,3-dihydro-, 1,1-dimethylethyl ester
Found 3 products.