CymitQuimica logo

CAS 1086392-62-2

:

6-Fluoro-benzooxazole-2-carboxylic acid methyl ester

Description:
6-Fluoro-benzooxazole-2-carboxylic acid methyl ester is a chemical compound characterized by its unique structure, which includes a benzooxazole ring fused with a carboxylic acid moiety and a methyl ester functional group. The presence of the fluorine atom at the 6-position of the benzooxazole ring enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anti-inflammatory properties. The methyl ester group can be hydrolyzed to yield the corresponding carboxylic acid, which may further expand its utility in synthetic chemistry. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can be determined through various analytical techniques, including NMR and mass spectrometry, aiding in its identification and characterization in research and industrial applications.
Formula:C9H6FNO3
InChI:InChI=1S/C9H6FNO3/c1-13-9(12)8-11-6-3-2-5(10)4-7(6)14-8/h2-4H,1H3
InChI key:RWDQANBOJUVGHH-UHFFFAOYSA-N
SMILES:COC(=O)C1=NC2=C(O1)C=C(C=C2)F
Synonyms:
  • 6-Fluoro-benzooxazole-2-carboxylic acid methyl ester
  • Methyl 6-fluorobenzo[d]oxazole-2-carboxylate
  • Methyl 6-fluoro-1,3-benzoxazole-2-carboxylate
Found 2 products.